About 4-(1,3-benzothiazol-2-yl)-N-methyl-N-[3-(propanoylamino)cyclopentyl]benzamide
4-(1,3-benzothiazol-2-yl)-N-methyl-N-[3-(propanoylamino)cyclopentyl]benzamide (PubChem CID 123313242) has the molecular formula C23H25N3O2S
and a molecular weight of 407.54 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-methyl-N-[3-(propanoylamino)cyclopentyl]benzamide.
Molecular Properties
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-methyl-N-[3-(propanoylamino)cyclopentyl]benzamide |
| PubChem CID | 123313242 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-methyl-N-[3-(propanoylamino)cyclopentyl]benzamide |
| SMILES | CCC(=O)NC1CCC(N(C)C(=O)c2ccc(-c3nc4ccccc4s3)cc2)C1 |
| InChI | InChI=1S/C23H25N3O2S/c1-3-21(27)24-17-12-13-18(14-17)26(2)23(28)16-10-8-15(9-11-16)22-25-19-6-4-5-7-20(19)29-22/h4-11,17-18H,3,12-14H2,1-2H3,(H,24,27) |
| InChIKey | DWDNUZRJIVQVLS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,3-benzothiazol-2-yl)-N-methyl-N-[3-(propanoylamino)cyclopentyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzothiazol-2-yl)-N-methyl-N-[3-(propanoylamino)cyclopentyl]benzamide?
The IUPAC name of 4-(1,3-benzothiazol-2-yl)-N-methyl-N-[3-(propanoylamino)cyclopentyl]benzamide (CID 123313242) is 4-(1,3-benzothiazol-2-yl)-N-methyl-N-[3-(propanoylamino)cyclopentyl]benzamide.
What is the SMILES notation for 4-(1,3-benzothiazol-2-yl)-N-methyl-N-[3-(propanoylamino)cyclopentyl]benzamide?
The canonical SMILES for 4-(1,3-benzothiazol-2-yl)-N-methyl-N-[3-(propanoylamino)cyclopentyl]benzamide is CCC(=O)NC1CCC(N(C)C(=O)c2ccc(-c3nc4ccccc4s3)cc2)C1.
What is the InChIKey of 4-(1,3-benzothiazol-2-yl)-N-methyl-N-[3-(propanoylamino)cyclopentyl]benzamide?
The InChIKey is DWDNUZRJIVQVLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O2S/c1-3-21(27)24-17-12-13-18(14-17)26(2)23(28)16-10-8-15(9-11-16)22-25-19-6-4-5-7-20(19)29-22/h4-11,17-18H,3,12-14H2,1-2H3,(H,24,27).
What are the key properties of 4-(1,3-benzothiazol-2-yl)-N-methyl-N-[3-(propanoylamino)cyclopentyl]benzamide?
4-(1,3-benzothiazol-2-yl)-N-methyl-N-[3-(propanoylamino)cyclopentyl]benzamide has a molecular weight of 407.54 g/mol, XLogP of 4.48, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzothiazol-2-yl)-N-methyl-N-[3-(propanoylamino)cyclopentyl]benzamide is sourced from PubChem (CID 123313242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).