C66H89O6P — CID 123313934
diphenyl [5,11,21-tritert-butyl-17-(2-ethyl-3,3-dimethylbut-1-enyl)-16,24,25-tripropoxy-23-tetracyclo[17.3.1.13,7.19,13]pentacosa-1(23),3,5,7(25),9,11,13(24),16,19,21-decaenyl] phosphite (PubChem CID 123313934) has the molecular formula C66H89O6P and a molecular weight of 1009.41 g/mol. Its IUPAC name is diphenyl [5,11,21-tritert-butyl-17-(2-ethyl-3,3-dimethylbut-1-enyl)-16,24,25-tripropoxy-23-tetracyclo[17.3.1.13,7.19,13]pentacosa-1(23),3,5,7(25),9,11,13(24),16,19,21-decaenyl] phosphite.
| Compound Name | diphenyl [5,11,21-tritert-butyl-17-(2-ethyl-3,3-dimethylbut-1-enyl)-16,24,25-tripropoxy-23-tetracyclo[17.3.1.13,7.19,13]pentacosa-1(23),3,5,7(25),9,11,13(24),16,19,21-decaenyl] phosphite |
|---|---|
| PubChem CID | 123313934 |
| Molecular Formula | C66H89O6P |
| Molecular Weight | 1009.41 g/mol |
| Exact Mass | 1008.64 |
| IUPAC Name | diphenyl [5,11,21-tritert-butyl-17-(2-ethyl-3,3-dimethylbut-1-enyl)-16,24,25-tripropoxy-23-tetracyclo[17.3.1.13,7.19,13]pentacosa-1(23),3,5,7(25),9,11,13(24),16,19,21-decaenyl] phosphite |
| SMILES | CCCOC1=C(C=C(CC)C(C)(C)C)Cc2cc(C(C)(C)C)cc(c2OP(Oc2ccccc2)Oc2ccccc2)Cc2cc(C(C)(C)C)cc(c2OCCC)Cc2cc(C(C)(C)C)cc(c2OCCC)CC1 |
| InChI | InChI=1S/C66H89O6P/c1-17-33-67-59-32-31-46-39-54(64(8,9)10)41-48(60(46)68-34-18-2)37-49-42-55(65(11,12)13)43-50(61(49)69-35-19-3)38-52-45-56(66(14,15)16)44-51(36-47(59)40-53(20-4)63(5,6)7)62(52)72-73(70-57-27-23-21-24-28-57)71-58-29-25-22-26-30-58/h21-30,39-45H,17-20,31-38H2,1-16H3 |
| InChIKey | DMMJSQAJRAETJQ-UHFFFAOYSA-N |
| XLogP | 18.65 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1009.41 |
| LogP ≤ 5 | 18.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|