C22H44N4O4S — CID 123314330
6-amino-2-[3-[2-[[4-methyl-4-(3-methylbutoxy)pentyl]amino]-2-oxoethyl]sulfanylpropanoylamino]hexanamide (PubChem CID 123314330) has the molecular formula C22H44N4O4S and a molecular weight of 460.69 g/mol. Its IUPAC name is 6-amino-2-[3-[2-[[4-methyl-4-(3-methylbutoxy)pentyl]amino]-2-oxoethyl]sulfanylpropanoylamino]hexanamide.
| Compound Name | 6-amino-2-[3-[2-[[4-methyl-4-(3-methylbutoxy)pentyl]amino]-2-oxoethyl]sulfanylpropanoylamino]hexanamide |
|---|---|
| PubChem CID | 123314330 |
| Molecular Formula | C22H44N4O4S |
| Molecular Weight | 460.69 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | 6-amino-2-[3-[2-[[4-methyl-4-(3-methylbutoxy)pentyl]amino]-2-oxoethyl]sulfanylpropanoylamino]hexanamide |
| SMILES | CC(C)CCOC(C)(C)CCCNC(=O)CSCCC(=O)NC(CCCCN)C(N)=O |
| InChI | InChI=1S/C22H44N4O4S/c1-17(2)9-14-30-22(3,4)11-7-13-25-20(28)16-31-15-10-19(27)26-18(21(24)29)8-5-6-12-23/h17-18H,5-16,23H2,1-4H3,(H2,24,29)(H,25,28)(H,26,27) |
| InChIKey | UUUBUNZPIFATSR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.69 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|