C13H24 — CID 123317251
2,3,4-trimethyldeca-2,4-diene (PubChem CID 123317251) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is 2,3,4-trimethyldeca-2,4-diene.
| Compound Name | 2,3,4-trimethyldeca-2,4-diene |
|---|---|
| PubChem CID | 123317251 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 2,3,4-trimethyldeca-2,4-diene |
| SMILES | CCCCCC=C(C)C(C)=C(C)C |
| InChI | InChI=1S/C13H24/c1-6-7-8-9-10-12(4)13(5)11(2)3/h10H,6-9H2,1-5H3 |
| InChIKey | SCTOOARIHUCVFH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|