C24H31BN6O4 — CID 123317794
6,7-dimethoxy-4-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperazin-1-yl]quinazoline (PubChem CID 123317794) has the molecular formula C24H31BN6O4 and a molecular weight of 478.36 g/mol. Its IUPAC name is 6,7-dimethoxy-4-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperazin-1-yl]quinazoline.
| Compound Name | 6,7-dimethoxy-4-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperazin-1-yl]quinazoline |
|---|---|
| PubChem CID | 123317794 |
| Molecular Formula | C24H31BN6O4 |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 6,7-dimethoxy-4-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperazin-1-yl]quinazoline |
| SMILES | COc1cc2ncnc(N3CCN(c4ncc(B5OC(C)(C)C(C)(C)O5)cn4)CC3)c2cc1OC |
| InChI | InChI=1S/C24H31BN6O4/c1-23(2)24(3,4)35-25(34-23)16-13-26-22(27-14-16)31-9-7-30(8-10-31)21-17-11-19(32-5)20(33-6)12-18(17)28-15-29-21/h11-15H,7-10H2,1-6H3 |
| InChIKey | DBTSRICWOUUBLP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 94.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|