C21H24FNO5S — CID 123317980
6-[4-[[4-(cyclopropylsulfonylmethyl)oxan-3-yl]methoxy]phenyl]-5-fluoropyridin-3-ol (PubChem CID 123317980) has the molecular formula C21H24FNO5S and a molecular weight of 421.49 g/mol. Its IUPAC name is 6-[4-[[4-(cyclopropylsulfonylmethyl)oxan-3-yl]methoxy]phenyl]-5-fluoropyridin-3-ol.
| Compound Name | 6-[4-[[4-(cyclopropylsulfonylmethyl)oxan-3-yl]methoxy]phenyl]-5-fluoropyridin-3-ol |
|---|---|
| PubChem CID | 123317980 |
| Molecular Formula | C21H24FNO5S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 6-[4-[[4-(cyclopropylsulfonylmethyl)oxan-3-yl]methoxy]phenyl]-5-fluoropyridin-3-ol |
| SMILES | O=S(=O)(CC1CCOCC1COc1ccc(-c2ncc(O)cc2F)cc1)C1CC1 |
| InChI | InChI=1S/C21H24FNO5S/c22-20-9-17(24)10-23-21(20)14-1-3-18(4-2-14)28-12-16-11-27-8-7-15(16)13-29(25,26)19-5-6-19/h1-4,9-10,15-16,19,24H,5-8,11-13H2 |
| InChIKey | KKNHADKRAOBOGM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |