C18H28N4 — CID 123319389
5-(5,5-dimethylazecan-1-yl)-3-methylpyrazolo[1,5-a]pyrimidine (PubChem CID 123319389) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is 5-(5,5-dimethylazecan-1-yl)-3-methylpyrazolo[1,5-a]pyrimidine.
| Compound Name | 5-(5,5-dimethylazecan-1-yl)-3-methylpyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 123319389 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 5-(5,5-dimethylazecan-1-yl)-3-methylpyrazolo[1,5-a]pyrimidine |
| SMILES | Cc1cnn2ccc(N3CCCCCC(C)(C)CCC3)nc12 |
| InChI | InChI=1S/C18H28N4/c1-15-14-19-22-13-8-16(20-17(15)22)21-11-6-4-5-9-18(2,3)10-7-12-21/h8,13-14H,4-7,9-12H2,1-3H3 |
| InChIKey | UHUSMFXGVNOLPF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |