C13H17N5O — CID 163575795
N-(3-methyloxiran-2-yl)-5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-3-amine (PubChem CID 163575795) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is N-(3-methyloxiran-2-yl)-5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-3-amine.
| Compound Name | N-(3-methyloxiran-2-yl)-5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-3-amine |
|---|---|
| PubChem CID | 163575795 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | N-(3-methyloxiran-2-yl)-5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-3-amine |
| SMILES | CC1OC1Nc1cnn2ccc(N3CCCC3)nc12 |
| InChI | InChI=1S/C13H17N5O/c1-9-13(19-9)15-10-8-14-18-7-4-11(16-12(10)18)17-5-2-3-6-17/h4,7-9,13,15H,2-3,5-6H2,1H3 |
| InChIKey | GDIZWBNZAFDIOB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|