C10H19N3 — CID 123320230
(2E)-2-(2-iminoethylidene)-3,5-dimethylhexanimidamide (PubChem CID 123320230) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is (2E)-2-(2-iminoethylidene)-3,5-dimethylhexanimidamide.
| Compound Name | (2E)-2-(2-iminoethylidene)-3,5-dimethylhexanimidamide |
|---|---|
| PubChem CID | 123320230 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | (2E)-2-(2-iminoethylidene)-3,5-dimethylhexanimidamide |
| SMILES | [H]/N=C(N)/C(=C/C=N/[H])C(C)CC(C)C |
| InChI | InChI=1S/C10H19N3/c1-7(2)6-8(3)9(4-5-11)10(12)13/h4-5,7-8,11H,6H2,1-3H3,(H3,12,13)/b9-4+,11-5+ |
| InChIKey | RCXYTNUSGULZSV-HINBXAKRSA-N |
| XLogP | 2.18 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|