C16H30N2 — CID 167480742
(2E)-N-butylidene-N',5-dimethyl-2-propylideneheptanimidamide (PubChem CID 167480742) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is (2E)-N-butylidene-N',5-dimethyl-2-propylideneheptanimidamide.
| Compound Name | (2E)-N-butylidene-N',5-dimethyl-2-propylideneheptanimidamide |
|---|---|
| PubChem CID | 167480742 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | (2E)-N-butylidene-N',5-dimethyl-2-propylideneheptanimidamide |
| SMILES | CC/C=C(CCC(C)CC)/C(=N/C)/N=C/CCC |
| InChI | InChI=1S/C16H30N2/c1-6-9-13-18-16(17-5)15(10-7-2)12-11-14(4)8-3/h10,13-14H,6-9,11-12H2,1-5H3/b15-10+,17-16-,18-13+ |
| InChIKey | AUQGOQORXPGXNB-VMXZQUIZSA-N |
| XLogP | 5.05 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|