C12H24O — CID 88943325
(3R,4E,7R)-4-ethylidene-7-methylnonan-3-ol (PubChem CID 88943325) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is (3R,4E,7R)-4-ethylidene-7-methylnonan-3-ol.
| Compound Name | (3R,4E,7R)-4-ethylidene-7-methylnonan-3-ol |
|---|---|
| PubChem CID | 88943325 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | (3R,4E,7R)-4-ethylidene-7-methylnonan-3-ol |
| SMILES | C/C=C(\CC[C@H](C)CC)[C@H](O)CC |
| InChI | InChI=1S/C12H24O/c1-5-10(4)8-9-11(6-2)12(13)7-3/h6,10,12-13H,5,7-9H2,1-4H3/b11-6+/t10-,12-/m1/s1 |
| InChIKey | MMMFKGCNDCZDLB-XXYKJJJTSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|