C12H23N3 — CID 162127743
2-(3,7-dimethyloct-6-enylideneamino)ethanimidamide (PubChem CID 162127743) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 2-(3,7-dimethyloct-6-enylideneamino)ethanimidamide.
| Compound Name | 2-(3,7-dimethyloct-6-enylideneamino)ethanimidamide |
|---|---|
| PubChem CID | 162127743 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 2-(3,7-dimethyloct-6-enylideneamino)ethanimidamide |
| SMILES | [H]/N=C(\N)C/N=C/CC(C)CCC=C(C)C |
| InChI | InChI=1S/C12H23N3/c1-10(2)5-4-6-11(3)7-8-15-9-12(13)14/h5,8,11H,4,6-7,9H2,1-3H3,(H3,13,14)/b15-8+ |
| InChIKey | CPVSCWNSRMHXSP-OVCLIPMQSA-N |
| XLogP | 2.77 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|