C12H22N3+ — CID 163569211
[1-amino-2-[[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]ethylidene]azanium (PubChem CID 163569211) has the molecular formula C12H22N3+ and a molecular weight of 208.33 g/mol. Its IUPAC name is [1-amino-2-[[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]ethylidene]azanium.
| Compound Name | [1-amino-2-[[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]ethylidene]azanium |
|---|---|
| PubChem CID | 163569211 |
| Molecular Formula | C12H22N3+ |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | [1-amino-2-[[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]ethylidene]azanium |
| SMILES | CC(C)=CCC/C(C)=C/C=N/CC(N)=[NH2+] |
| InChI | InChI=1S/C12H21N3/c1-10(2)5-4-6-11(3)7-8-15-9-12(13)14/h5,7-8H,4,6,9H2,1-3H3,(H3,13,14)/p+1/b11-7+,15-8+ |
| InChIKey | FXULVNVXFQWQHB-YQQAFNMCSA-O |
| XLogP | 0.87 |
| TPSA | 63.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|