C10H18N2 — CID 169233484
[(E)-[(2E,6E)-3-methylocta-2,6-dienylidene]amino]methanamine (PubChem CID 169233484) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is [(E)-[(2E,6E)-3-methylocta-2,6-dienylidene]amino]methanamine.
| Compound Name | [(E)-[(2E,6E)-3-methylocta-2,6-dienylidene]amino]methanamine |
|---|---|
| PubChem CID | 169233484 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | [(E)-[(2E,6E)-3-methylocta-2,6-dienylidene]amino]methanamine |
| SMILES | C/C=C/CC/C(C)=C/C=N/CN |
| InChI | InChI=1S/C10H18N2/c1-3-4-5-6-10(2)7-8-12-9-11/h3-4,7-8H,5-6,9,11H2,1-2H3/b4-3+,10-7+,12-8+ |
| InChIKey | ZHCFIVPAKUFWRK-DCMHWLISSA-N |
| XLogP | 2.28 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|