C12H21N3 — CID 160588047
2-[[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]ethanimidamide (PubChem CID 160588047) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-[[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]ethanimidamide.
| Compound Name | 2-[[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]ethanimidamide |
|---|---|
| PubChem CID | 160588047 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 2-[[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]ethanimidamide |
| SMILES | [H]/N=C(\N)C/N=C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C12H21N3/c1-10(2)5-4-6-11(3)7-8-15-9-12(13)14/h5,7-8H,4,6,9H2,1-3H3,(H3,13,14)/b11-7+,15-8+ |
| InChIKey | FXULVNVXFQWQHB-YQQAFNMCSA-N |
| XLogP | 2.69 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|