C11H17NO — CID 123321527
10-imino-7-methyldeca-1,6-dien-5-one (PubChem CID 123321527) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 10-imino-7-methyldeca-1,6-dien-5-one.
| Compound Name | 10-imino-7-methyldeca-1,6-dien-5-one |
|---|---|
| PubChem CID | 123321527 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 10-imino-7-methyldeca-1,6-dien-5-one |
| SMILES | [H]/N=C/CCC(C)=CC(=O)CCC=C |
| InChI | InChI=1S/C11H17NO/c1-3-4-7-11(13)9-10(2)6-5-8-12/h3,8-9,12H,1,4-7H2,2H3/b10-9?,12-8+ |
| InChIKey | JZFNCWMWHAKYTB-QJQJIATLSA-N |
| XLogP | 2.90 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|