C16H30S — CID 123322222
4-ethyl-3,4-dimethyl-2-(propylsulfanylmethyl)octa-1,5-diene (PubChem CID 123322222) has the molecular formula C16H30S and a molecular weight of 254.48 g/mol. Its IUPAC name is 4-ethyl-3,4-dimethyl-2-(propylsulfanylmethyl)octa-1,5-diene.
| Compound Name | 4-ethyl-3,4-dimethyl-2-(propylsulfanylmethyl)octa-1,5-diene |
|---|---|
| PubChem CID | 123322222 |
| Molecular Formula | C16H30S |
| Molecular Weight | 254.48 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | 4-ethyl-3,4-dimethyl-2-(propylsulfanylmethyl)octa-1,5-diene |
| SMILES | C=C(CSCCC)C(C)C(C)(C=CCC)CC |
| InChI | InChI=1S/C16H30S/c1-7-10-11-16(6,9-3)15(5)14(4)13-17-12-8-2/h10-11,15H,4,7-9,12-13H2,1-3,5-6H3 |
| InChIKey | VRARBSHVBLYUJY-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|