C27H29FN2O — CID 123323192
(4E)-6-(4-fluorophenyl)-8-methoxy-3-methyl-4-pentylidene-2-pyridin-3-yl-2,3-dihydro-1H-quinoline (PubChem CID 123323192) has the molecular formula C27H29FN2O and a molecular weight of 416.54 g/mol. Its IUPAC name is (4E)-6-(4-fluorophenyl)-8-methoxy-3-methyl-4-pentylidene-2-pyridin-3-yl-2,3-dihydro-1H-quinoline.
| Compound Name | (4E)-6-(4-fluorophenyl)-8-methoxy-3-methyl-4-pentylidene-2-pyridin-3-yl-2,3-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 123323192 |
| Molecular Formula | C27H29FN2O |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | (4E)-6-(4-fluorophenyl)-8-methoxy-3-methyl-4-pentylidene-2-pyridin-3-yl-2,3-dihydro-1H-quinoline |
| SMILES | CCCC/C=C1/c2cc(-c3ccc(F)cc3)cc(OC)c2NC(c2cccnc2)C1C |
| InChI | InChI=1S/C27H29FN2O/c1-4-5-6-9-23-18(2)26(20-8-7-14-29-17-20)30-27-24(23)15-21(16-25(27)31-3)19-10-12-22(28)13-11-19/h7-18,26,30H,4-6H2,1-3H3/b23-9+ |
| InChIKey | ODUPMBNHHDKCSS-NUGSKGIGSA-N |
| XLogP | 7.27 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|