C14H14N2O — CID 25180102
4-methyl-7-pyridin-3-yl-2,3-dihydro-1,4-benzoxazine (PubChem CID 25180102) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is 4-methyl-7-pyridin-3-yl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 4-methyl-7-pyridin-3-yl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 25180102 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 4-methyl-7-pyridin-3-yl-2,3-dihydro-1,4-benzoxazine |
| SMILES | CN1CCOc2cc(-c3cccnc3)ccc21 |
| InChI | InChI=1S/C14H14N2O/c1-16-7-8-17-14-9-11(4-5-13(14)16)12-3-2-6-15-10-12/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | YBIUDQZQNQCPTN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |