C14H17ClO4 — CID 123323960
(3-methylcyclopentyl)methyl 3-chloro-4,5-dihydroxybenzoate (PubChem CID 123323960) has the molecular formula C14H17ClO4 and a molecular weight of 284.74 g/mol. Its IUPAC name is (3-methylcyclopentyl)methyl 3-chloro-4,5-dihydroxybenzoate.
| Compound Name | (3-methylcyclopentyl)methyl 3-chloro-4,5-dihydroxybenzoate |
|---|---|
| PubChem CID | 123323960 |
| Molecular Formula | C14H17ClO4 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (3-methylcyclopentyl)methyl 3-chloro-4,5-dihydroxybenzoate |
| SMILES | CC1CCC(COC(=O)c2cc(O)c(O)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H17ClO4/c1-8-2-3-9(4-8)7-19-14(18)10-5-11(15)13(17)12(16)6-10/h5-6,8-9,16-17H,2-4,7H2,1H3 |
| InChIKey | ZHDULIFXZHQXBD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|