C23H43N3O5 — CID 123324040
3-tert-butyl-1-cyclohexyl-1-[6-[4,5-dihydroxy-2-(hydroxymethyl)-3-oxopiperidin-1-yl]hexyl]urea (PubChem CID 123324040) has the molecular formula C23H43N3O5 and a molecular weight of 441.61 g/mol. Its IUPAC name is 3-tert-butyl-1-cyclohexyl-1-[6-[4,5-dihydroxy-2-(hydroxymethyl)-3-oxopiperidin-1-yl]hexyl]urea.
| Compound Name | 3-tert-butyl-1-cyclohexyl-1-[6-[4,5-dihydroxy-2-(hydroxymethyl)-3-oxopiperidin-1-yl]hexyl]urea |
|---|---|
| PubChem CID | 123324040 |
| Molecular Formula | C23H43N3O5 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.32 |
| IUPAC Name | 3-tert-butyl-1-cyclohexyl-1-[6-[4,5-dihydroxy-2-(hydroxymethyl)-3-oxopiperidin-1-yl]hexyl]urea |
| SMILES | CC(C)(C)NC(=O)N(CCCCCCN1CC(O)C(O)C(=O)C1CO)C1CCCCC1 |
| InChI | InChI=1S/C23H43N3O5/c1-23(2,3)24-22(31)26(17-11-7-6-8-12-17)14-10-5-4-9-13-25-15-19(28)21(30)20(29)18(25)16-27/h17-19,21,27-28,30H,4-16H2,1-3H3,(H,24,31) |
| InChIKey | MYFRETUSAGYCQN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|