C23H45N3O4 — CID 123731834
3-tert-butyl-1-cyclohexyl-1-[6-[4,5-dihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]urea (PubChem CID 123731834) has the molecular formula C23H45N3O4 and a molecular weight of 427.63 g/mol. Its IUPAC name is 3-tert-butyl-1-cyclohexyl-1-[6-[4,5-dihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]urea.
| Compound Name | 3-tert-butyl-1-cyclohexyl-1-[6-[4,5-dihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]urea |
|---|---|
| PubChem CID | 123731834 |
| Molecular Formula | C23H45N3O4 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.34 |
| IUPAC Name | 3-tert-butyl-1-cyclohexyl-1-[6-[4,5-dihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]urea |
| SMILES | CC(C)(C)NC(=O)N(CCCCCCN1CC(O)C(O)CC1CO)C1CCCCC1 |
| InChI | InChI=1S/C23H45N3O4/c1-23(2,3)24-22(30)26(18-11-7-6-8-12-18)14-10-5-4-9-13-25-16-21(29)20(28)15-19(25)17-27/h18-21,27-29H,4-17H2,1-3H3,(H,24,30) |
| InChIKey | AOSOGNSCZKEZFW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|