About pent-2-ene-1,1,5-tricarbonitrile
pent-2-ene-1,1,5-tricarbonitrile (PubChem CID 123327097) has the molecular formula C8H7N3
and a molecular weight of 145.16 g/mol. Its IUPAC name is pent-2-ene-1,1,5-tricarbonitrile.
Molecular Properties
| Compound Name | pent-2-ene-1,1,5-tricarbonitrile |
| PubChem CID | 123327097 |
| Molecular Formula | C8H7N3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | pent-2-ene-1,1,5-tricarbonitrile |
| SMILES | N#CCCC=CC(C#N)C#N |
| InChI | InChI=1S/C8H7N3/c9-5-3-1-2-4-8(6-10)7-11/h2,4,8H,1,3H2 |
| InChIKey | ABAATJCUFVYUOH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pent-2-ene-1,1,5-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-2-ene-1,1,5-tricarbonitrile?
The IUPAC name of pent-2-ene-1,1,5-tricarbonitrile (CID 123327097) is pent-2-ene-1,1,5-tricarbonitrile.
What is the SMILES notation for pent-2-ene-1,1,5-tricarbonitrile?
The canonical SMILES for pent-2-ene-1,1,5-tricarbonitrile is N#CCCC=CC(C#N)C#N.
What is the InChIKey of pent-2-ene-1,1,5-tricarbonitrile?
The InChIKey is ABAATJCUFVYUOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3/c9-5-3-1-2-4-8(6-10)7-11/h2,4,8H,1,3H2.
What are the key properties of pent-2-ene-1,1,5-tricarbonitrile?
pent-2-ene-1,1,5-tricarbonitrile has a molecular weight of 145.16 g/mol, XLogP of 1.51, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pent-2-ene-1,1,5-tricarbonitrile is sourced from PubChem (CID 123327097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).