C8H7N3 — CID 123327097
pent-2-ene-1,1,5-tricarbonitrile (PubChem CID 123327097) has the molecular formula C8H7N3 and a molecular weight of 145.16 g/mol. Its IUPAC name is pent-2-ene-1,1,5-tricarbonitrile.
| Compound Name | pent-2-ene-1,1,5-tricarbonitrile |
|---|---|
| PubChem CID | 123327097 |
| Molecular Formula | C8H7N3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | pent-2-ene-1,1,5-tricarbonitrile |
| SMILES | N#CCCC=CC(C#N)C#N |
| InChI | InChI=1S/C8H7N3/c9-5-3-1-2-4-8(6-10)7-11/h2,4,8H,1,3H2 |
| InChIKey | ABAATJCUFVYUOH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|