About 8-cyanooct-5-enoic acid
8-cyanooct-5-enoic acid (PubChem CID 71348210) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 8-cyanooct-5-enoic acid.
Molecular Properties
| Compound Name | 8-cyanooct-5-enoic acid |
| PubChem CID | 71348210 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 8-cyanooct-5-enoic acid |
| SMILES | N#CCCC=CCCCC(=O)O |
| InChI | InChI=1S/C9H13NO2/c10-8-6-4-2-1-3-5-7-9(11)12/h1-2H,3-7H2,(H,11,12) |
| InChIKey | YPUXGKWWGWBRHI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-cyanooct-5-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-cyanooct-5-enoic acid?
The IUPAC name of 8-cyanooct-5-enoic acid (CID 71348210) is 8-cyanooct-5-enoic acid.
What is the SMILES notation for 8-cyanooct-5-enoic acid?
The canonical SMILES for 8-cyanooct-5-enoic acid is N#CCCC=CCCCC(=O)O.
What is the InChIKey of 8-cyanooct-5-enoic acid?
The InChIKey is YPUXGKWWGWBRHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c10-8-6-4-2-1-3-5-7-9(11)12/h1-2H,3-7H2,(H,11,12).
What are the key properties of 8-cyanooct-5-enoic acid?
8-cyanooct-5-enoic acid has a molecular weight of 167.21 g/mol, XLogP of 2.10, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-cyanooct-5-enoic acid is sourced from PubChem (CID 71348210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).