C10H13FN2 — CID 123327195
5-fluoro-2,6,6-trimethyl-1,5-dihydrobenzimidazole (PubChem CID 123327195) has the molecular formula C10H13FN2 and a molecular weight of 180.23 g/mol. Its IUPAC name is 5-fluoro-2,6,6-trimethyl-1,5-dihydrobenzimidazole.
| Compound Name | 5-fluoro-2,6,6-trimethyl-1,5-dihydrobenzimidazole |
|---|---|
| PubChem CID | 123327195 |
| Molecular Formula | C10H13FN2 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 5-fluoro-2,6,6-trimethyl-1,5-dihydrobenzimidazole |
| SMILES | Cc1nc2c([nH]1)=CC(C)(C)C(F)C=2 |
| InChI | InChI=1S/C10H13FN2/c1-6-12-7-4-9(11)10(2,3)5-8(7)13-6/h4-5,9H,1-3H3,(H,12,13) |
| InChIKey | ZVKYZHULUVJANR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |