About (6Z)-8-methyl-4,5-dimethylidene-3-propan-2-ylidenenona-6,8-dien-2-imine
(6Z)-8-methyl-4,5-dimethylidene-3-propan-2-ylidenenona-6,8-dien-2-imine (PubChem CID 123327586) has the molecular formula C15H21N
and a molecular weight of 215.34 g/mol. Its IUPAC name is (6Z)-8-methyl-4,5-dimethylidene-3-propan-2-ylidenenona-6,8-dien-2-imine.
Molecular Properties
| Compound Name | (6Z)-8-methyl-4,5-dimethylidene-3-propan-2-ylidenenona-6,8-dien-2-imine |
| PubChem CID | 123327586 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (6Z)-8-methyl-4,5-dimethylidene-3-propan-2-ylidenenona-6,8-dien-2-imine |
| SMILES | [H]/N=C(\C)C(C(=C)C(=C)/C=C\C(=C)C)=C(C)C |
| InChI | InChI=1S/C15H21N/c1-10(2)8-9-12(5)13(6)15(11(3)4)14(7)16/h8-9,16H,1,5-6H2,2-4,7H3/b9-8-,16-14+ |
| InChIKey | AWQJBIKOAFTERR-ZMPHJAQOSA-N |
| XLogP | 4.61 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-8-methyl-4,5-dimethylidene-3-propan-2-ylidenenona-6,8-dien-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-8-methyl-4,5-dimethylidene-3-propan-2-ylidenenona-6,8-dien-2-imine?
The IUPAC name of (6Z)-8-methyl-4,5-dimethylidene-3-propan-2-ylidenenona-6,8-dien-2-imine (CID 123327586) is (6Z)-8-methyl-4,5-dimethylidene-3-propan-2-ylidenenona-6,8-dien-2-imine.
What is the SMILES notation for (6Z)-8-methyl-4,5-dimethylidene-3-propan-2-ylidenenona-6,8-dien-2-imine?
The canonical SMILES for (6Z)-8-methyl-4,5-dimethylidene-3-propan-2-ylidenenona-6,8-dien-2-imine is [H]/N=C(\C)C(C(=C)C(=C)/C=C\C(=C)C)=C(C)C.
What is the InChIKey of (6Z)-8-methyl-4,5-dimethylidene-3-propan-2-ylidenenona-6,8-dien-2-imine?
The InChIKey is AWQJBIKOAFTERR-ZMPHJAQOSA-N. The full InChI is InChI=1S/C15H21N/c1-10(2)8-9-12(5)13(6)15(11(3)4)14(7)16/h8-9,16H,1,5-6H2,2-4,7H3/b9-8-,16-14+.
What are the key properties of (6Z)-8-methyl-4,5-dimethylidene-3-propan-2-ylidenenona-6,8-dien-2-imine?
(6Z)-8-methyl-4,5-dimethylidene-3-propan-2-ylidenenona-6,8-dien-2-imine has a molecular weight of 215.34 g/mol, XLogP of 4.61, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-8-methyl-4,5-dimethylidene-3-propan-2-ylidenenona-6,8-dien-2-imine is sourced from PubChem (CID 123327586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).