C22H25N3OS — CID 123327989
5-[[1-(1-amino-2,3-dihydro-1H-inden-4-yl)-2-iminoethyl]sulfanylmethyl]-2-propan-2-yloxybenzonitrile (PubChem CID 123327989) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is 5-[[1-(1-amino-2,3-dihydro-1H-inden-4-yl)-2-iminoethyl]sulfanylmethyl]-2-propan-2-yloxybenzonitrile.
| Compound Name | 5-[[1-(1-amino-2,3-dihydro-1H-inden-4-yl)-2-iminoethyl]sulfanylmethyl]-2-propan-2-yloxybenzonitrile |
|---|---|
| PubChem CID | 123327989 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 5-[[1-(1-amino-2,3-dihydro-1H-inden-4-yl)-2-iminoethyl]sulfanylmethyl]-2-propan-2-yloxybenzonitrile |
| SMILES | [H]/N=C/C(SCc1ccc(OC(C)C)c(C#N)c1)c1cccc2c1CCC2N |
| InChI | InChI=1S/C22H25N3OS/c1-14(2)26-21-9-6-15(10-16(21)11-23)13-27-22(12-24)19-5-3-4-18-17(19)7-8-20(18)25/h3-6,9-10,12,14,20,22,24H,7-8,13,25H2,1-2H3/b24-12+ |
| InChIKey | ISGINDRIGKOOST-WYMPLXKRSA-N |
| XLogP | 4.92 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|