C27H35N5O3S — CID 123338643
(3-cyano-4-propan-2-yloxyphenyl)methyl N-amino-1-[[2-hydroxyethyl(propyl)carbamoyl]amino]-2,3-dihydro-1H-indene-4-carboximidothioate (PubChem CID 123338643) has the molecular formula C27H35N5O3S and a molecular weight of 509.68 g/mol. Its IUPAC name is (3-cyano-4-propan-2-yloxyphenyl)methyl N-amino-1-[[2-hydroxyethyl(propyl)carbamoyl]amino]-2,3-dihydro-1H-indene-4-carboximidothioate.
| Compound Name | (3-cyano-4-propan-2-yloxyphenyl)methyl N-amino-1-[[2-hydroxyethyl(propyl)carbamoyl]amino]-2,3-dihydro-1H-indene-4-carboximidothioate |
|---|---|
| PubChem CID | 123338643 |
| Molecular Formula | C27H35N5O3S |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | (3-cyano-4-propan-2-yloxyphenyl)methyl N-amino-1-[[2-hydroxyethyl(propyl)carbamoyl]amino]-2,3-dihydro-1H-indene-4-carboximidothioate |
| SMILES | CCCN(CCO)C(=O)NC1CCc2c(C(=NN)SCc3ccc(OC(C)C)c(C#N)c3)cccc21 |
| InChI | InChI=1S/C27H35N5O3S/c1-4-12-32(13-14-33)27(34)30-24-10-9-21-22(24)6-5-7-23(21)26(31-29)36-17-19-8-11-25(35-18(2)3)20(15-19)16-28/h5-8,11,15,18,24,33H,4,9-10,12-14,17,29H2,1-3H3,(H,30,34) |
| InChIKey | LOOLFZJMQITYOH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 123.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|