C27H33N3O3 — CID 123285877
methyl 3-cyano-N-[1-[1-[ethyl(2-hydroxyethyl)amino]-2,3-dihydro-1H-inden-4-yl]ethenyl]-4-propan-2-yloxybenzenecarboximidate (PubChem CID 123285877) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is methyl 3-cyano-N-[1-[1-[ethyl(2-hydroxyethyl)amino]-2,3-dihydro-1H-inden-4-yl]ethenyl]-4-propan-2-yloxybenzenecarboximidate.
| Compound Name | methyl 3-cyano-N-[1-[1-[ethyl(2-hydroxyethyl)amino]-2,3-dihydro-1H-inden-4-yl]ethenyl]-4-propan-2-yloxybenzenecarboximidate |
|---|---|
| PubChem CID | 123285877 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | methyl 3-cyano-N-[1-[1-[ethyl(2-hydroxyethyl)amino]-2,3-dihydro-1H-inden-4-yl]ethenyl]-4-propan-2-yloxybenzenecarboximidate |
| SMILES | C=C(/N=C(\OC)c1ccc(OC(C)C)c(C#N)c1)c1cccc2c1CCC2N(CC)CCO |
| InChI | InChI=1S/C27H33N3O3/c1-6-30(14-15-31)25-12-11-23-22(8-7-9-24(23)25)19(4)29-27(32-5)20-10-13-26(33-18(2)3)21(16-20)17-28/h7-10,13,16,18,25,31H,4,6,11-12,14-15H2,1-3,5H3/b29-27- |
| InChIKey | ACVWTOQSBVOODS-OHYPFYFLSA-N |
| XLogP | 4.71 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|