C30H37N5O6 — CID 155759234
[(Z)-[amino-[(1S)-1-[tert-butyl-[2-(dimethylamino)-2-oxoethoxy]carbonylamino]-2,3-dihydro-1H-inden-4-yl]methylidene]amino] 3-cyano-4-propan-2-yloxybenzoate (PubChem CID 155759234) has the molecular formula C30H37N5O6 and a molecular weight of 563.66 g/mol. Its IUPAC name is [(Z)-[amino-[(1S)-1-[tert-butyl-[2-(dimethylamino)-2-oxoethoxy]carbonylamino]-2,3-dihydro-1H-inden-4-yl]methylidene]amino] 3-cyano-4-propan-2-yloxybenzoate.
| Compound Name | [(Z)-[amino-[(1S)-1-[tert-butyl-[2-(dimethylamino)-2-oxoethoxy]carbonylamino]-2,3-dihydro-1H-inden-4-yl]methylidene]amino] 3-cyano-4-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 155759234 |
| Molecular Formula | C30H37N5O6 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | [(Z)-[amino-[(1S)-1-[tert-butyl-[2-(dimethylamino)-2-oxoethoxy]carbonylamino]-2,3-dihydro-1H-inden-4-yl]methylidene]amino] 3-cyano-4-propan-2-yloxybenzoate |
| SMILES | CC(C)Oc1ccc(C(=O)O/N=C(\N)c2cccc3c2CC[C@@H]3N(C(=O)OCC(=O)N(C)C)C(C)(C)C)cc1C#N |
| InChI | InChI=1S/C30H37N5O6/c1-18(2)40-25-14-11-19(15-20(25)16-31)28(37)41-33-27(32)23-10-8-9-22-21(23)12-13-24(22)35(30(3,4)5)29(38)39-17-26(36)34(6)7/h8-11,14-15,18,24H,12-13,17H2,1-7H3,(H2,32,33)/t24-/m0/s1 |
| InChIKey | CJJDTZGOBGFPIB-DEOSSOPVSA-N |
| XLogP | 4.14 |
| TPSA | 147.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|