C34H48N4O6Si — CID 140732155
[(Z)-[amino-[(1R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2,3-dihydro-1H-inden-4-yl]methylidene]amino] 3-isocyano-4-propan-2-yloxybenzoate (PubChem CID 140732155) has the molecular formula C34H48N4O6Si and a molecular weight of 636.87 g/mol. Its IUPAC name is [(Z)-[amino-[(1R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2,3-dihydro-1H-inden-4-yl]methylidene]amino] 3-isocyano-4-propan-2-yloxybenzoate.
| Compound Name | [(Z)-[amino-[(1R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2,3-dihydro-1H-inden-4-yl]methylidene]amino] 3-isocyano-4-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 140732155 |
| Molecular Formula | C34H48N4O6Si |
| Molecular Weight | 636.87 g/mol |
| Exact Mass | 636.33 |
| IUPAC Name | [(Z)-[amino-[(1R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2,3-dihydro-1H-inden-4-yl]methylidene]amino] 3-isocyano-4-propan-2-yloxybenzoate |
| SMILES | [C-]#[N+]c1cc(C(=O)O/N=C(\N)c2cccc3c2CC[C@H]3N(CCO[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C)ccc1OC(C)C |
| InChI | InChI=1S/C34H48N4O6Si/c1-22(2)42-29-18-15-23(21-27(29)36-9)31(39)44-37-30(35)26-14-12-13-25-24(26)16-17-28(25)38(32(40)43-33(3,4)5)19-20-41-45(10,11)34(6,7)8/h12-15,18,21-22,28H,16-17,19-20H2,1-8,10-11H3,(H2,35,37)/t28-/m1/s1 |
| InChIKey | KPAUFKDYQGKBEV-MUUNZHRXSA-N |
| XLogP | 7.75 |
| TPSA | 117.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.87 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|