C25H29N3O3 — CID 123680945
5-[1-[1-[1-(2-hydroxyethylamino)-2,3-dihydro-1H-inden-4-yl]ethylideneamino]ethenyl]-2-(2-methoxyethoxy)benzonitrile (PubChem CID 123680945) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 5-[1-[1-[1-(2-hydroxyethylamino)-2,3-dihydro-1H-inden-4-yl]ethylideneamino]ethenyl]-2-(2-methoxyethoxy)benzonitrile.
| Compound Name | 5-[1-[1-[1-(2-hydroxyethylamino)-2,3-dihydro-1H-inden-4-yl]ethylideneamino]ethenyl]-2-(2-methoxyethoxy)benzonitrile |
|---|---|
| PubChem CID | 123680945 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 5-[1-[1-[1-(2-hydroxyethylamino)-2,3-dihydro-1H-inden-4-yl]ethylideneamino]ethenyl]-2-(2-methoxyethoxy)benzonitrile |
| SMILES | C=C(/N=C(\C)c1cccc2c1CCC2NCCO)c1ccc(OCCOC)c(C#N)c1 |
| InChI | InChI=1S/C25H29N3O3/c1-17(19-7-10-25(20(15-19)16-26)31-14-13-30-3)28-18(2)21-5-4-6-23-22(21)8-9-24(23)27-11-12-29/h4-7,10,15,24,27,29H,1,8-9,11-14H2,2-3H3/b28-18+ |
| InChIKey | NLBDIWMXQRIYHB-MTDXEUNCSA-N |
| XLogP | 3.63 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|