C26H31N3O2S — CID 123311810
5-[1-[[2-[1-(2-hydroxyethylamino)-2,3-dihydro-1H-inden-4-yl]-2-sulfanylideneethylidene]amino]propyl]-2-propan-2-yloxybenzonitrile (PubChem CID 123311810) has the molecular formula C26H31N3O2S and a molecular weight of 449.62 g/mol. Its IUPAC name is 5-[1-[[2-[1-(2-hydroxyethylamino)-2,3-dihydro-1H-inden-4-yl]-2-sulfanylideneethylidene]amino]propyl]-2-propan-2-yloxybenzonitrile.
| Compound Name | 5-[1-[[2-[1-(2-hydroxyethylamino)-2,3-dihydro-1H-inden-4-yl]-2-sulfanylideneethylidene]amino]propyl]-2-propan-2-yloxybenzonitrile |
|---|---|
| PubChem CID | 123311810 |
| Molecular Formula | C26H31N3O2S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 5-[1-[[2-[1-(2-hydroxyethylamino)-2,3-dihydro-1H-inden-4-yl]-2-sulfanylideneethylidene]amino]propyl]-2-propan-2-yloxybenzonitrile |
| SMILES | CCC(/N=C/C(=S)c1cccc2c1CCC2NCCO)c1ccc(OC(C)C)c(C#N)c1 |
| InChI | InChI=1S/C26H31N3O2S/c1-4-23(18-8-11-25(31-17(2)3)19(14-18)15-27)29-16-26(32)22-7-5-6-21-20(22)9-10-24(21)28-12-13-30/h5-8,11,14,16-17,23-24,28,30H,4,9-10,12-13H2,1-3H3/b29-16+ |
| InChIKey | NMXVTPMOWFENAP-MUFRIFMGSA-N |
| XLogP | 4.85 |
| TPSA | 77.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|