C27H28N4O2S — CID 123792230
methyl 3-cyano-4-propan-2-yloxy-N-[1-[1-(1,3-thiazol-5-ylmethylamino)-2,3-dihydro-1H-inden-4-yl]ethenyl]benzenecarboximidate (PubChem CID 123792230) has the molecular formula C27H28N4O2S and a molecular weight of 472.61 g/mol. Its IUPAC name is methyl 3-cyano-4-propan-2-yloxy-N-[1-[1-(1,3-thiazol-5-ylmethylamino)-2,3-dihydro-1H-inden-4-yl]ethenyl]benzenecarboximidate.
| Compound Name | methyl 3-cyano-4-propan-2-yloxy-N-[1-[1-(1,3-thiazol-5-ylmethylamino)-2,3-dihydro-1H-inden-4-yl]ethenyl]benzenecarboximidate |
|---|---|
| PubChem CID | 123792230 |
| Molecular Formula | C27H28N4O2S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | methyl 3-cyano-4-propan-2-yloxy-N-[1-[1-(1,3-thiazol-5-ylmethylamino)-2,3-dihydro-1H-inden-4-yl]ethenyl]benzenecarboximidate |
| SMILES | C=C(/N=C(\OC)c1ccc(OC(C)C)c(C#N)c1)c1cccc2c1CCC2NCc1cncs1 |
| InChI | InChI=1S/C27H28N4O2S/c1-17(2)33-26-11-8-19(12-20(26)13-28)27(32-4)31-18(3)22-6-5-7-24-23(22)9-10-25(24)30-15-21-14-29-16-34-21/h5-8,11-12,14,16-17,25,30H,3,9-10,15H2,1-2,4H3/b31-27- |
| InChIKey | FWNQWEPXYDAYQP-QVTSOHHYSA-N |
| XLogP | 5.64 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|