C29H28N4OS — CID 118460364
5-[5-[(5R)-5-(benzylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]-1,3,4-thiadiazol-2-yl]-2-propan-2-yloxybenzonitrile (PubChem CID 118460364) has the molecular formula C29H28N4OS and a molecular weight of 480.64 g/mol. Its IUPAC name is 5-[5-[(5R)-5-(benzylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]-1,3,4-thiadiazol-2-yl]-2-propan-2-yloxybenzonitrile.
| Compound Name | 5-[5-[(5R)-5-(benzylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]-1,3,4-thiadiazol-2-yl]-2-propan-2-yloxybenzonitrile |
|---|---|
| PubChem CID | 118460364 |
| Molecular Formula | C29H28N4OS |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 5-[5-[(5R)-5-(benzylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]-1,3,4-thiadiazol-2-yl]-2-propan-2-yloxybenzonitrile |
| SMILES | CC(C)Oc1ccc(-c2nnc(-c3cccc4c3CCC[C@H]4NCc3ccccc3)s2)cc1C#N |
| InChI | InChI=1S/C29H28N4OS/c1-19(2)34-27-15-14-21(16-22(27)17-30)28-32-33-29(35-28)25-12-6-11-24-23(25)10-7-13-26(24)31-18-20-8-4-3-5-9-20/h3-6,8-9,11-12,14-16,19,26,31H,7,10,13,18H2,1-2H3/t26-/m1/s1 |
| InChIKey | SQASHRUNMUDLBE-AREMUKBSSA-N |
| XLogP | 6.70 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |