C28H27N5OS — CID 123631073
(1R)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-N-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 123631073) has the molecular formula C28H27N5OS and a molecular weight of 481.63 g/mol. Its IUPAC name is (1R)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-N-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1R)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-N-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 123631073 |
| Molecular Formula | C28H27N5OS |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | (1R)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-N-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | [C-]#[N+]c1cc(-c2nnc(-c3cccc4c3CCC[C@H]4NCc3cccnc3)s2)ccc1OC(C)C |
| InChI | InChI=1S/C28H27N5OS/c1-18(2)34-26-13-12-20(15-25(26)29-3)27-32-33-28(35-27)23-10-4-9-22-21(23)8-5-11-24(22)31-17-19-7-6-14-30-16-19/h4,6-7,9-10,12-16,18,24,31H,5,8,11,17H2,1-2H3/t24-/m1/s1 |
| InChIKey | REFJBFLQOCKCOV-XMMPIXPASA-N |
| XLogP | 6.77 |
| TPSA | 64.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|