C22H22N4OS — CID 123595645
(1R)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 123595645) has the molecular formula C22H22N4OS and a molecular weight of 390.51 g/mol. Its IUPAC name is (1R)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1R)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 123595645 |
| Molecular Formula | C22H22N4OS |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (1R)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | [C-]#[N+]c1cc(-c2nnc(-c3cccc4c3CCC[C@H]4N)s2)ccc1OC(C)C |
| InChI | InChI=1S/C22H22N4OS/c1-13(2)27-20-11-10-14(12-19(20)24-3)21-25-26-22(28-21)17-8-4-7-16-15(17)6-5-9-18(16)23/h4,7-8,10-13,18H,5-6,9,23H2,1-2H3/t18-/m1/s1 |
| InChIKey | XNNOCRDLVBPNCT-GOSISDBHSA-N |
| XLogP | 5.55 |
| TPSA | 65.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|