C22H21N3O2 — CID 123220032
(1R)-4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2-oxazol-3-yl]-2,3-dihydro-1H-inden-1-amine (PubChem CID 123220032) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is (1R)-4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2-oxazol-3-yl]-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1R)-4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2-oxazol-3-yl]-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 123220032 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (1R)-4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2-oxazol-3-yl]-2,3-dihydro-1H-inden-1-amine |
| SMILES | [C-]#[N+]c1cc(-c2cc(-c3cccc4c3CC[C@H]4N)no2)ccc1OC(C)C |
| InChI | InChI=1S/C22H21N3O2/c1-13(2)26-21-10-7-14(11-20(21)24-3)22-12-19(25-27-22)17-6-4-5-16-15(17)8-9-18(16)23/h4-7,10-13,18H,8-9,23H2,1-2H3/t18-/m1/s1 |
| InChIKey | RQOFCLDSLXUVTC-GOSISDBHSA-N |
| XLogP | 5.29 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|