C27H29N5OS — CID 89215451
(1R)-5-[5-(3-amino-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-N-(pyridin-4-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 89215451) has the molecular formula C27H29N5OS and a molecular weight of 471.63 g/mol. Its IUPAC name is (1R)-5-[5-(3-amino-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-N-(pyridin-4-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1R)-5-[5-(3-amino-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-N-(pyridin-4-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 89215451 |
| Molecular Formula | C27H29N5OS |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | (1R)-5-[5-(3-amino-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-N-(pyridin-4-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CC(C)Oc1ccc(-c2nnc(-c3cccc4c3CCC[C@H]4NCc3ccncc3)s2)cc1N |
| InChI | InChI=1S/C27H29N5OS/c1-17(2)33-25-10-9-19(15-23(25)28)26-31-32-27(34-26)22-7-3-6-21-20(22)5-4-8-24(21)30-16-18-11-13-29-14-12-18/h3,6-7,9-15,17,24,30H,4-5,8,16,28H2,1-2H3/t24-/m1/s1 |
| InChIKey | MTXCRSVTMKXXBW-XMMPIXPASA-N |
| XLogP | 5.80 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|