C27H30N4O3S — CID 123156430
tert-butyl N-[(1R)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate (PubChem CID 123156430) has the molecular formula C27H30N4O3S and a molecular weight of 490.63 g/mol. Its IUPAC name is tert-butyl N-[(1R)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1R)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 123156430 |
| Molecular Formula | C27H30N4O3S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | tert-butyl N-[(1R)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate |
| SMILES | [C-]#[N+]c1cc(-c2nnc(-c3cccc4c3CCC[C@H]4NC(=O)OC(C)(C)C)s2)ccc1OC(C)C |
| InChI | InChI=1S/C27H30N4O3S/c1-16(2)33-23-14-13-17(15-22(23)28-6)24-30-31-25(35-24)20-11-7-10-19-18(20)9-8-12-21(19)29-26(32)34-27(3,4)5/h7,10-11,13-16,21H,8-9,12H2,1-5H3,(H,29,32)/t21-/m1/s1 |
| InChIKey | YTMDJZIPOJQEAI-OAQYLSRUSA-N |
| XLogP | 7.11 |
| TPSA | 77.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|