C27H30N4O3S — CID 71040803
tert-butyl N-[(1S)-5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate (PubChem CID 71040803) has the molecular formula C27H30N4O3S and a molecular weight of 490.63 g/mol. Its IUPAC name is tert-butyl N-[(1S)-5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1S)-5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 71040803 |
| Molecular Formula | C27H30N4O3S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | tert-butyl N-[(1S)-5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]carbamate |
| SMILES | CC(C)Oc1ccc(-c2nnc(-c3cccc4c3CCC[C@@H]4NC(=O)OC(C)(C)C)s2)cc1C#N |
| InChI | InChI=1S/C27H30N4O3S/c1-16(2)33-23-13-12-17(14-18(23)15-28)24-30-31-25(35-24)21-10-6-9-20-19(21)8-7-11-22(20)29-26(32)34-27(3,4)5/h6,9-10,12-14,16,22H,7-8,11H2,1-5H3,(H,29,32)/t22-/m0/s1 |
| InChIKey | VJCNDNHMYJAWKD-QFIPXVFZSA-N |
| XLogP | 6.43 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |