C25H26N4O3S — CID 71040769
methyl 2-[[(1R)-5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]acetate (PubChem CID 71040769) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is methyl 2-[[(1R)-5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]acetate.
| Compound Name | methyl 2-[[(1R)-5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]acetate |
|---|---|
| PubChem CID | 71040769 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | methyl 2-[[(1R)-5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]acetate |
| SMILES | COC(=O)CN[C@@H]1CCCc2c(-c3nnc(-c4ccc(OC(C)C)c(C#N)c4)s3)cccc21 |
| InChI | InChI=1S/C25H26N4O3S/c1-15(2)32-22-11-10-16(12-17(22)13-26)24-28-29-25(33-24)20-8-4-7-19-18(20)6-5-9-21(19)27-14-23(30)31-3/h4,7-8,10-12,15,21,27H,5-6,9,14H2,1-3H3/t21-/m1/s1 |
| InChIKey | OSTBLGJCCZYOJA-OAQYLSRUSA-N |
| XLogP | 4.67 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |