C25H26N4O5S2 — CID 139431005
(2S)-2-[[5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]propanoic acid (PubChem CID 139431005) has the molecular formula C25H26N4O5S2 and a molecular weight of 526.64 g/mol. Its IUPAC name is (2S)-2-[[5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]propanoic acid.
| Compound Name | (2S)-2-[[5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 139431005 |
| Molecular Formula | C25H26N4O5S2 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | (2S)-2-[[5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]propanoic acid |
| SMILES | CC(C)Oc1ccc(-c2nnc(-c3cccc4c3CCCC4NS(=O)(=O)[C@@H](C)C(=O)O)s2)cc1C#N |
| InChI | InChI=1S/C25H26N4O5S2/c1-14(2)34-22-11-10-16(12-17(22)13-26)23-27-28-24(35-23)20-8-4-7-19-18(20)6-5-9-21(19)29-36(32,33)15(3)25(30)31/h4,7-8,10-12,14-15,21,29H,5-6,9H2,1-3H3,(H,30,31)/t15-,21?/m0/s1 |
| InChIKey | RLDPOYRRFPGZLH-ZDGMYTEDSA-N |
| XLogP | 4.30 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |