C25H28N4O3S — CID 139438145
5-[5-[(5R)-5-[(1-hydroxy-2-methoxyethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-yl]-1,3,4-thiadiazol-2-yl]-2-propan-2-yloxybenzonitrile (PubChem CID 139438145) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is 5-[5-[(5R)-5-[(1-hydroxy-2-methoxyethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-yl]-1,3,4-thiadiazol-2-yl]-2-propan-2-yloxybenzonitrile.
| Compound Name | 5-[5-[(5R)-5-[(1-hydroxy-2-methoxyethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-yl]-1,3,4-thiadiazol-2-yl]-2-propan-2-yloxybenzonitrile |
|---|---|
| PubChem CID | 139438145 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 5-[5-[(5R)-5-[(1-hydroxy-2-methoxyethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-yl]-1,3,4-thiadiazol-2-yl]-2-propan-2-yloxybenzonitrile |
| SMILES | COCC(O)N[C@@H]1CCCc2c(-c3nnc(-c4ccc(OC(C)C)c(C#N)c4)s3)cccc21 |
| InChI | InChI=1S/C25H28N4O3S/c1-15(2)32-22-11-10-16(12-17(22)13-26)24-28-29-25(33-24)20-8-4-7-19-18(20)6-5-9-21(19)27-23(30)14-31-3/h4,7-8,10-12,15,21,23,27,30H,5-6,9,14H2,1-3H3/t21-,23?/m1/s1 |
| InChIKey | VTHSDRZGUQZTPI-FKHAVUOCSA-N |
| XLogP | 4.46 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|