C22H24N4OS — CID 139438195
5-[5-(5-amino-5,6,7,8-tetrahydronaphthalen-1-yl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]-2-propan-2-yloxybenzonitrile (PubChem CID 139438195) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is 5-[5-(5-amino-5,6,7,8-tetrahydronaphthalen-1-yl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]-2-propan-2-yloxybenzonitrile.
| Compound Name | 5-[5-(5-amino-5,6,7,8-tetrahydronaphthalen-1-yl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]-2-propan-2-yloxybenzonitrile |
|---|---|
| PubChem CID | 139438195 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 5-[5-(5-amino-5,6,7,8-tetrahydronaphthalen-1-yl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]-2-propan-2-yloxybenzonitrile |
| SMILES | CC(C)Oc1ccc(C2NN=C(c3cccc4c3CCCC4N)S2)cc1C#N |
| InChI | InChI=1S/C22H24N4OS/c1-13(2)27-20-10-9-14(11-15(20)12-23)21-25-26-22(28-21)18-7-3-6-17-16(18)5-4-8-19(17)24/h3,6-7,9-11,13,19,21,25H,4-5,8,24H2,1-2H3 |
| InChIKey | HTAVGHLRLPNVEU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 83.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |