C26H28N2 — CID 164817442
(1R)-5-[4-[(5R)-5-amino-5,6,7,8-tetrahydronaphthalen-1-yl]phenyl]-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 164817442) has the molecular formula C26H28N2 and a molecular weight of 368.52 g/mol. Its IUPAC name is (1R)-5-[4-[(5R)-5-amino-5,6,7,8-tetrahydronaphthalen-1-yl]phenyl]-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1R)-5-[4-[(5R)-5-amino-5,6,7,8-tetrahydronaphthalen-1-yl]phenyl]-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 164817442 |
| Molecular Formula | C26H28N2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | (1R)-5-[4-[(5R)-5-amino-5,6,7,8-tetrahydronaphthalen-1-yl]phenyl]-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | N[C@@H]1CCCc2c(-c3ccc(-c4cccc5c4CCC[C@H]5N)cc3)cccc21 |
| InChI | InChI=1S/C26H28N2/c27-25-11-3-7-21-19(5-1-9-23(21)25)17-13-15-18(16-14-17)20-6-2-10-24-22(20)8-4-12-26(24)28/h1-2,5-6,9-10,13-16,25-26H,3-4,7-8,11-12,27-28H2/t25-,26-/m1/s1 |
| InChIKey | MYZFOSVITLCPTL-CLJLJLNGSA-N |
| XLogP | 5.69 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |