C12H17N5O3 — CID 123328019
2-amino-9-[4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-3,6-dihydropurin-6-ol (PubChem CID 123328019) has the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-amino-9-[4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-3,6-dihydropurin-6-ol.
| Compound Name | 2-amino-9-[4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-3,6-dihydropurin-6-ol |
|---|---|
| PubChem CID | 123328019 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-amino-9-[4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-3,6-dihydropurin-6-ol |
| SMILES | C=C1C(CO)C(O)CC1n1cnc2c1NC(N)=NC2O |
| InChI | InChI=1S/C12H17N5O3/c1-5-6(3-18)8(19)2-7(5)17-4-14-9-10(17)15-12(13)16-11(9)20/h4,6-8,11,18-20H,1-3H2,(H3,13,15,16) |
| InChIKey | DFXAXXUVCDKDQD-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|