C20H20Cl3FO2S — CID 123329662
2,2,2-trichloroethyl 2-[2-(4-fluorophenyl)ethylsulfanyl]-3-(4-methylphenyl)propanoate (PubChem CID 123329662) has the molecular formula C20H20Cl3FO2S and a molecular weight of 449.80 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-[2-(4-fluorophenyl)ethylsulfanyl]-3-(4-methylphenyl)propanoate.
| Compound Name | 2,2,2-trichloroethyl 2-[2-(4-fluorophenyl)ethylsulfanyl]-3-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 123329662 |
| Molecular Formula | C20H20Cl3FO2S |
| Molecular Weight | 449.80 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | 2,2,2-trichloroethyl 2-[2-(4-fluorophenyl)ethylsulfanyl]-3-(4-methylphenyl)propanoate |
| SMILES | Cc1ccc(CC(SCCc2ccc(F)cc2)C(=O)OCC(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C20H20Cl3FO2S/c1-14-2-4-16(5-3-14)12-18(19(25)26-13-20(21,22)23)27-11-10-15-6-8-17(24)9-7-15/h2-9,18H,10-13H2,1H3 |
| InChIKey | YNQUPUXLMCPCCF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.80 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|