C28H32ClNO4 — CID 123330590
tert-butyl 2-[[3-[4-(3-chlorophenyl)phenyl]-1-hydroxy-1-phenylmethoxypropan-2-yl]amino]acetate (PubChem CID 123330590) has the molecular formula C28H32ClNO4 and a molecular weight of 482.02 g/mol. Its IUPAC name is tert-butyl 2-[[3-[4-(3-chlorophenyl)phenyl]-1-hydroxy-1-phenylmethoxypropan-2-yl]amino]acetate.
| Compound Name | tert-butyl 2-[[3-[4-(3-chlorophenyl)phenyl]-1-hydroxy-1-phenylmethoxypropan-2-yl]amino]acetate |
|---|---|
| PubChem CID | 123330590 |
| Molecular Formula | C28H32ClNO4 |
| Molecular Weight | 482.02 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | tert-butyl 2-[[3-[4-(3-chlorophenyl)phenyl]-1-hydroxy-1-phenylmethoxypropan-2-yl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CNC(Cc1ccc(-c2cccc(Cl)c2)cc1)C(O)OCc1ccccc1 |
| InChI | InChI=1S/C28H32ClNO4/c1-28(2,3)34-26(31)18-30-25(27(32)33-19-21-8-5-4-6-9-21)16-20-12-14-22(15-13-20)23-10-7-11-24(29)17-23/h4-15,17,25,27,30,32H,16,18-19H2,1-3H3 |
| InChIKey | QRXXPXCILURUGA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.02 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|