C13H25NO — CID 123330789
5-(2,3-dimethylbutyl)-2,4-dimethyl-1,2,3,6-tetrahydropyridin-6-ol (PubChem CID 123330789) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 5-(2,3-dimethylbutyl)-2,4-dimethyl-1,2,3,6-tetrahydropyridin-6-ol.
| Compound Name | 5-(2,3-dimethylbutyl)-2,4-dimethyl-1,2,3,6-tetrahydropyridin-6-ol |
|---|---|
| PubChem CID | 123330789 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 5-(2,3-dimethylbutyl)-2,4-dimethyl-1,2,3,6-tetrahydropyridin-6-ol |
| SMILES | CC1=C(CC(C)C(C)C)C(O)NC(C)C1 |
| InChI | InChI=1S/C13H25NO/c1-8(2)9(3)7-12-10(4)6-11(5)14-13(12)15/h8-9,11,13-15H,6-7H2,1-5H3 |
| InChIKey | NZCCOAVETAUAMN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|